Flupirtine Maleate
Flupirtine maleate is a non-opioid analgesic of KV7 potassium channels. Flupirtine also inderectly antagonizes NMDA receptor and GABAa receptors. It exhibits the relaxantion of muscles and neuroprotective.
| Trivial name | / |
| Catalog Number | CSN18763 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C19H21FN4O6 |
| CAS# | 75507-68-5 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=C(N=C1N)NCC2=CC=C(C=C2)F)OCC.O=C(/C=C\C(O)=O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/flupirtine-maleate.html |
