Fenofibric Acid
Fenofibric acid is an agonist of PPAR that can regulate lipid level. It also exhibits inhibition of COX-2.
| Trivial name | NSC 281318; FNF Acid |
| Catalog Number | CSN18750 |
| Alternative Name(s) | NSC 281318; FNF Acid |
| Research Area | / |
| Molecular Formula | C17H15ClO4 |
| CAS# | 42017-89-0 |
| Purity | ≥99% |
| SMILES | CC(C)(OC1=CC=C(C(C2=CC=C(Cl)C=C2)=O)C=C1)C(O)=O |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/fenofibric-acid.html |