Parthenolide
Parthenolide is a sesquiterpene lactone from the plant feverfew (T. parthenium) with multiple biological functions. Parthenolide inhibits the growth of the promastigote form of L. amazonensis with IC50 of 3.6 μg/mL, induces apoptosis in cancer cells and blocks inflammation by inhibiting signaling through NF-κB.
| Trivial name | Parthenolide; PTL |
| Catalog Number | CSN18699 |
| Alternative Name(s) | Parthenolide; PTL |
| Research Area | Cancer |
| Molecular Formula | C15H20O3 |
| CAS# | 20554-84-1 |
| Purity | ≥98% |
| SMILES | O=C(O[C@@]1([H])[C@@]2([H])CC/C(C)=C/CC[C@]3(C)[C@]1([H])O3)C2=C |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/parthenolide.html |