cGAMP
cGAMP, an endogenous second messenger, can induce the formation of cytokines and promote innate immune response. It also acts as an activator of STING with antitumor activity.
| Trivial name | Cyclic AMP-GMP |
| Catalog Number | CSN18467 |
| Alternative Name(s) | Cyclic AMP-GMP |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C20H24N10O13P2 |
| CAS# | 849214-04-6 |
| Purity | ≥98% |
| SMILES | O=P(O[C@H]1[C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N)O[C@@H]1COP4(O)=O)(O)OC[C@@H]5[C@@H](O4)[C@@H](O)[C@H](N6C=NC7=C6N=C(N)NC7=O)O5 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/cgamp.html |