Dinaciclib
Dinaciclib is a potent CDK inhibitor for CDK2, CDK5, CDK1 and CDK9 with IC50 of 1 nM, 1 nM, 3 nM and 4 nM, respectively.
| Trivial name | PS-095760; SCH-727965 |
| Catalog Number | CSN18431 |
| Alternative Name(s) | PS-095760; SCH-727965 |
| Research Area | Cancer |
| Molecular Formula | C21H28N6O2 |
| CAS# | 779353-01-4 |
| Purity | ≥99% |
| SMILES | OCC[C@H]1N(CCCC1)C2=NC3=C(C=NN3C(NCC4=C[N+]([O-])=CC=C4)=C2)CC |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/dinaciclib.html |