Ligustrazine HCl
Ligustrazine HCl is a natural product isolated and purified from the rhizomes of Ligusticum chuanxiong Hort. with protective effect on the vascular endothelium undergoing CPB and homocysteine-injured ECV304 cells.
| Trivial name | Chuanxiongzine HCl |
| Catalog Number | CSN18424 |
| Alternative Name(s) | Chuanxiongzine HCl |
| Research Area | / |
| Molecular Formula | C8H13ClN2 |
| CAS# | 76494-51-4 |
| Purity | ≥99% |
| SMILES | CC1=C(C)N=C(C)C(C)=N1.[H]Cl |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ligustrazine-hcl.html |