ICI-118551 HCl
ICI 118551 HCl is a selective and inverse β2 adrenergic receptor antagonist with Ki values of 1.2, 120 and 257nM for β2, β1 and β3 receptors, respectively.
| Trivial name | / |
| Catalog Number | CSN18407 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C17H28ClNO2 |
| CAS# | 72795-01-8 |
| Purity | ≥99% |
| SMILES | C[C@@H](NC(C)C)[C@@H](O)COC1=CC=C(C)C2=C1CCC2.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/ici-118551-hcl.html |