Veratramine
Veratramine is a natually occuring alkaloid isolated from the rhizomes of Veratrum and can inhibit the Hh signaling-dependent proliferation of NIH/3T3 cells for it is an analog of cyclopamine.
| Trivial name | NSNSC 17821; NSC-23880 |
| Catalog Number | CSN18358 |
| Alternative Name(s) | NSNSC 17821; NSC-23880 |
| Research Area | Cancer |
| Molecular Formula | C27H39NO2 |
| CAS# | 60-70-8 |
| Purity | ≥99% |
| SMILES | O[C@H]1[C@H]([C@H](C2=C(C)C3=C(C=C2)[C@]4([H])CC=C(C[C@@H](O)CC5)[C@@]5(C)[C@@]4([H])C3)C)NC[C@@H](C)C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/veratramine.html |