Columbamine
Columbamine is a quaternary isoquinoline alkaloid isolated and purified from the roots of Coptis chinensis Franch, shows strong activity with IC50 48.1 µM and exerts anti-proliferative and anti-vasculogenic effects on metastatic human osteosarcoma U2OS cells with low toxicity.
| Trivial name | Columbamin |
| Catalog Number | CSN18241 |
| Alternative Name(s) | Columbamin |
| Research Area | / |
| Molecular Formula | C20H20NO4 |
| CAS# | 3621-36-1 |
| Purity | ≥98% |
| SMILES | COC1=C(OC)C2=C[N+]3=C(C4=CC(O)=C(OC)C=C4CC3)C=C2C=C1 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/columbamine.html |