SU6656
SU 6656 is an inhibitor of Src kinases and can target Src, Yes, Lyn, and Fyn with IC50 of 280 nM, 20 nM, 130 nM, 170 nM, respectively.
| Trivial name | / |
| Catalog Number | CSN18218 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C19H21N3O3S |
| CAS# | 330161-87-0 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC2=C(NC(/C2=C\C(N3)=CC4=C3CCCC4)=O)C=C1)(N(C)C)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/su6656.html |