NPS-2143 HCl
NPS-2143 HCl is a potent and selective calcium ion-sensing receptor antagonist with IC50 of 43 and 41 nM for cytoplasmic Ca2+ concentrations and parathyroid hormone secretion, respectively.
| Trivial name | / |
| Catalog Number | CSN18211 |
| Alternative Name(s) | / |
| Research Area | Metabolic Disease |
| Molecular Formula | C24H26Cl2N2O2 |
| CAS# | 324523-20-8 |
| Purity | ≥99% |
| SMILES | N#CC1=C(OC[C@@H](CNC(C)(C)CC2=CC=C3C=CC=CC3=C2)O)C=CC=C1Cl.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/nps-2143-hcl.html |