MCC950 Sodium
MCC950 Sodium is a potent and highly specific small molecule inhibitor of NLRP3 inflammasome with IC50 of 7.5 nM in BMDMs.
| Trivial name | CP-456773 Sodium; CRID-3 Sodium Salt |
| Catalog Number | CSN18163 |
| Alternative Name(s) | CP-456773 Sodium; CRID-3 Sodium Salt |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C20H23N2NaO5S |
| CAS# | 256373-96-3 |
| Purity | ≥99% |
| SMILES | CC(O)(C1=COC(S(=O)([N-]C(NC2=C3CCCC3=CC4=C2CCC4)=O)=O)=C1)C.[Na+] |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/mcc950-sodium.html |
