NSC 59984
NSC 59984 is a reactivator of p53 which targets various mutant p53 to restore wild-type p53 pathway via the activation of p73 in cancer cells. It could induce p53 mutant protein degradation via MDM2-mediated ubiquitination.
| Trivial name | / |
| Catalog Number | CSN17369 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C12H15N3O4 |
| CAS# | 803647-40-7 |
| Purity | ≥99% |
| SMILES | O=C(N1CCN(C)CC1)/C=C/C2=CC=C([N+]([O-])=O)O2 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/nsc-59984.html |