Luminol
Luminol is a chemical with chemiluminescence property, soluble in most polar organic solvents, insoluble in water. When mixed with an appropriate oxidizing agent, it emits a blue glow.
| Trivial name | Diogenes Reagent |
| Catalog Number | CSN17295 |
| Alternative Name(s) | Diogenes Reagent |
| Research Area | / |
| Molecular Formula | C8H7N3O2 |
| CAS# | 521-31-3 |
| Purity | ≥99% |
| SMILES | NC1=C2C(=O)NNC(=O)C2=CC=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/luminol.html |
