Gatifloxacin HCl
Gatifloxacin HCl is a fourth-generation fluoroquinolone antibiotic working by inhibiting the bacterial enzymes DNA gyrase and topoisomerase IV.
| Trivial name | AM 1155 HCl; BMS-20658401 HCl |
| Catalog Number | CSN17226 |
| Alternative Name(s) | AM 1155 HCl; BMS-20658401 HCl |
| Research Area | Infection |
| Molecular Formula | C19H23ClFN3O4 |
| CAS# | 121577-32-0 |
| Purity | ≥99% |
| SMILES | O=C(C1=CN(C2CC2)C3=C(C=C(F)C(N4CC(C)NCC4)=C3OC)C1=O)O.[H]Cl |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/gatifloxacin-hcl.html |