Butoconazole Nitrate
Butoconazole nitrate is an anti-fungal agent and the IC50s of IL-2, TNFα, IFN and GM-CSF are 7.2 μg/mL, 14.4 μg/mL, 7.36 μg/mL and 7.6 μg/mL, respectively.
| Trivial name | RS-35887 |
| Catalog Number | CSN17109 |
| Alternative Name(s) | RS-35887 |
| Research Area | Infection |
| Molecular Formula | C19H18Cl3N3O3S |
| CAS# | 64872-77-1 |
| Purity | ≥99% |
| SMILES | ClC1=C(SC(CCC2=CC=C(Cl)C=C2)CN3C=CN=C3)C(Cl)=CC=C1.O[N+]([O-])=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/butoconazole-nitrate.html |
