Ribavirin
Ribavirin blocks nucleic acid synthesis and inhibits both RNA and DNA viruses. Ribavirin is a nucleoside antimetabolite antiviral agent.
| Trivial name | NSC 163039; ICN 1229; RTCA; Tribavirin |
| Catalog Number | CSN17086 |
| Alternative Name(s) | NSC 163039; ICN 1229; RTCA; Tribavirin |
| Research Area | Infection |
| Molecular Formula | C8H12N4O5 |
| CAS# | 36791-04-5 |
| Purity | ≥99% |
| SMILES | [C@@H]2([N]1N=C(C(N)=O)N=C1)O[C@H](CO)[C@H]([C@H]2O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/ribavirin.html |
