Ribavirin
Ribavirin blocks nucleic acid synthesis and inhibits both RNA and DNA viruses. Ribavirin is a nucleoside antimetabolite antiviral agent.
Trivial name | NSC 163039; ICN 1229; RTCA; Tribavirin |
Catalog Number | CSN17086 |
Alternative Name(s) | NSC 163039; ICN 1229; RTCA; Tribavirin |
Research Area | Infection |
Molecular Formula | C8H12N4O5 |
CAS# | 36791-04-5 |
Purity | ≥99% |
SMILES | [C@@H]2([N]1N=C(C(N)=O)N=C1)O[C@H](CO)[C@H]([C@H]2O)O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/ribavirin.html |