(S)-(+)-Ibuprofen
(S)-(+)-Ibuprofen, the S-enantiomer of ibuprofen, is capable of inhibiting cyclooxygenase (COX) at clinically relevant concentrations, R(-)-ibuprofen is not a COX inhibitor. S(+)-Ibuprofen prevents neurodegeneration and cognitive decline in APPswe/PS1dE9 through multiple signaling pathways
| Trivial name | (S)-Ibuprofen; (+)-Ibuprofen; Dexibuprofen |
| Catalog Number | CSN17031 |
| Alternative Name(s) | (S)-Ibuprofen; (+)-Ibuprofen; Dexibuprofen |
| Research Area | Immunology/Inflammation|Neurological Disease |
| Molecular Formula | C13H18O2 |
| CAS# | 51146-56-6 |
| Purity | ≥99% |
| SMILES | [C@H](C1=CC=C(CC(C)C)C=C1)(C(O)=O)C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/(s)-(+)-ibuprofen.html |