Semagacestat
Semagacestat is an inhibitor of γ-secretase. It inhibits Aβ42, Aβ38, Aβ40 and the Notch signaling with IC50 of 10 nM, 12 nM, 12.1 nM and 14.1 nM.
| Trivial name | LY-450139 |
| Catalog Number | CSN16909 |
| Alternative Name(s) | LY-450139 |
| Research Area | Neurological Disease |
| Molecular Formula | C19H27N3O4 |
| CAS# | 425386-60-3 |
| Purity | ≥98% |
| SMILES | CC([C@@H](C(N[C@H](C(N[C@H]1C2=CC=CC=C2CCN(C1=O)C)=O)C)=O)O)C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/semagacestat.html |
