Taxifolin
Taxifolin is an inhibitor of VEGFR-2 kinase and collagenase (IC50 = 193.3 μM) and it can be found in many plants such as taxus chinensis, siberian larch, cedrus deodara and so on.
| Trivial name | Dihydroquercetin; (+)-Dihydroquercetin; (+)-Taxifolin; Taxifoliol |
| Catalog Number | CSN16850 |
| Alternative Name(s) | Dihydroquercetin; (+)-Dihydroquercetin; (+)-Taxifolin; Taxifoliol |
| Research Area | Cancer|Infection|Metabolic Disease |
| Molecular Formula | C15H12O7 |
| CAS# | 480-18-2 |
| Purity | ≥99% |
| SMILES | O=C1[C@H](O)[C@@H](C2=CC=C(O)C(O)=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/taxifolin.html |
