Methotrexate
Methotrexate, an antifolate compound, is a nonspecific inhibitor of the dihydrofolate reductase(DHFR) of bacteria and cancerous cells as well as normal cells. It forms an inactive ternary complex with DHFR and NADPH and can interfere with the growth of certain cells of the body, especially cells that reproduce quickly, such as cancer cells, bone marrow cells, and skin cells.

Trivial name | NCI-C04671; CL14377; WR-19039 |
Catalog Number | CSN16844 |
Alternative Name(s) | NCI-C04671; CL14377; WR-19039 |
Research Area | Cancer|Immunology/Inflammation |
Molecular Formula | C20H22N8O5 |
CAS# | 59-05-2 |
Purity | ≥99% |
SMILES | O=C(O)[C@@H](NC(C1=CC=C(N(CC2=NC3=C(N)N=C(N)N=C3N=C2)C)C=C1)=O)CCC(O)=O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/methotrexate.html |