Ozagrel HCl
Ozagrel HCl is a selective thromboxane A(2) (TXA(2)) synthetase inhibitor with IC50 of 11 nM for rabbit platelet, used for the improvement of postoperative cerebrovascular contraction and accompanying cerebral ischaemia.
| Trivial name | OKY-046 HCl |
| Catalog Number | CSN16785 |
| Alternative Name(s) | OKY-046 HCl |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C13H13ClN2O2 |
| CAS# | 78712-43-3 |
| Purity | ≥99% |
| SMILES | O=C(O)/C=C/C1=CC=C(CN2C=CN=C2)C=C1.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ozagrel-hcl.html |