Rofecoxib
Rofecoxib is a potent inhibitor of the COX2-dependent production of PGE2 in human osteosarcoma cells with IC50 of 26±10 nM and Chinese hamster ovary cells expressing human COX-2 with IC50 of 18±7 nM.
| Trivial name | MK-0966 |
| Catalog Number | CSN16719 |
| Alternative Name(s) | MK-0966 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C17H14O4S |
| CAS# | 162011-90-7 |
| Purity | ≥99% |
| SMILES | O=C1OCC(C2=CC=C(S(=O)(C)=O)C=C2)=C1C3=CC=CC=C3 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/rofecoxib.html |