Pemetrexed Disodium
Pemetrexed Disodium is an antifolate and antimetabolite for TS, DHFR and GARFT with Ki of 1.3 nM, 7.2 nM and 65 nM, respectively.
| Trivial name | LY-231514 Disodium |
| Catalog Number | CSN16714 |
| Alternative Name(s) | LY-231514 Disodium |
| Research Area | Cancer |
| Molecular Formula | C20H19N5Na2O6 |
| CAS# | 150399-23-8 |
| Purity | ≥99% |
| SMILES | O=C([C@H](CCC([O-])=O)NC(C1=CC=C(C=C1)CCC2=CNC(NC(N)=N3)=C2C3=O)=O)[O-].[Na+].[Na+] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/pemetrexed-disodium.html |