Diacerein
Diacerein is a symptomatic slow-acting medicine in osteoarthritis which can reduce the level of IL-1 receptors leading to fewer receptors to form heterodimer complexes.
Trivial name | SF 277 |
Catalog Number | CSN16710 |
Alternative Name(s) | SF 277 |
Research Area | Immunology/Inflammation |
Molecular Formula | C19H12O8 |
CAS# | 13739-02-1 |
Purity | ≥99% |
SMILES | O=C(C1=C2C(OC(C)=O)=CC=C1)C3=CC(C(O)=O)=CC(OC(C)=O)=C3C2=O |
Size | 100mg |
Supplier Page | https://www.csnpharm.com/products/diacerein.html |