Loganin
Loganin is a naturally occuring iridoid glycoside with antioxidant, hepatoprotective and neuroprotective effects, as well as a COX-1 inhbitor with IC50 value of 3.55 µM, suppressing the formation of TNF-α, and diminishing the production of nitric oxide.
| Trivial name | Loganoside |
| Catalog Number | CSN16607 |
| Alternative Name(s) | Loganoside |
| Research Area | / |
| Molecular Formula | C17H26O10 |
| CAS# | 18524-94-2 |
| Purity | ≥98% |
| SMILES | O=C(C1=CO[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@@]3([H])[C@]1([H])C[C@H](O)[C@@H]3C)OC |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/loganin.html |