Fludarabine Phosphate
Fludarabine phosphate is an analogue of adenosine and deoxyadenosine, which is able to compete with dATP for incorporation into DNA and inhibit DNA synthesis.
| Trivial name | F-Ara-A Phosphate; NSC 312887 Phosphate |
| Catalog Number | CSN16461 |
| Alternative Name(s) | F-Ara-A Phosphate; NSC 312887 Phosphate |
| Research Area | Cancer |
| Molecular Formula | C10H13FN5O7P |
| CAS# | 75607-67-9 |
| Purity | ≥99% |
| SMILES | O=P(O)(OC[C@H]1O[C@@H](N2C=NC3=C(N)N=C(F)N=C23)[C@@H](O)[C@@H]1O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/fludarabine-phosphate.html |