1-Deoxynojirimycin
1-Deoxynojirimycin is a potent α-glucosidase inhibitor, suppresses postprandial blood glucose, thereby possibly preventing diabetes mellitus. It’s a natural product isolated and purified from the root barks of Morus alba L..
| Trivial name | Duvoglustat, DNJ |
| Catalog Number | CSN16455 |
| Alternative Name(s) | Duvoglustat, DNJ |
| Research Area | Metabolic Disease |
| Molecular Formula | C6H13NO4 |
| CAS# | 19130-96-2 |
| Purity | ≥98% |
| SMILES | O[C@@H]1[C@@H](CO)NC[C@H](O)[C@H]1O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/1-deoxynojirimycin.html |