Tioconazole
Tioconazole is an imidazole antifungal used to treat infections caused by a fungus or yeast, working by disrupting cell wall synthesis through inhibiting the biosynthesis of ergosterol or other sterols.

Trivial name | UK-20349; Vagistat 1 |
Catalog Number | CSN16446 |
Alternative Name(s) | UK-20349; Vagistat 1 |
Research Area | Infection |
Molecular Formula | C16H13Cl3N2OS |
CAS# | 65899-73-2 |
Purity | ≥99% |
SMILES | ClC1=CC=C(C(OCC2=C(Cl)SC=C2)CN3C=CN=C3)C(Cl)=C1 |
Size | 250mg |
Supplier Page | https://www.csnpharm.com/products/tioconazole.html |