Wogonin
Wogonin acts as an inhibitor of COX2 with IC50 of 46 μM without affecting COX-1 and inhibits the NF-κB pathway-mediated iNOs induction. Wogonin can be isolated from the root of scutellaria baicalensis georgi.
| Trivial name | Vogonin |
| Catalog Number | CSN16440 |
| Alternative Name(s) | Vogonin |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C16H12O5 |
| CAS# | 632-85-9 |
| Purity | ≥99% |
| SMILES | COC1=C(O)C=C(O)C2=C1OC(C3=CC=CC=C3)=CC2=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/wogonin.html |