Peimine
Peimine can inhibit the production of inflammatory cytokines induced by LPS and block MAPK and NF-κB signaling pathways. It is purified from the bulbus of fritillaria thunbergii.
| Trivial name | Verticine |
| Catalog Number | CSN16196 |
| Alternative Name(s) | Verticine |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C27H45NO3 |
| CAS# | 23496-41-5 |
| Purity | ≥98% |
| SMILES | [H][C@]12[C@]3([H])C[C@H](O)[C@@]4([H])C[C@@H](O)CC[C@]4(C)[C@@]3([H])C[C@]([H])1[C@]5([H])CN6C[C@@H](C)CC[C@]([H])6[C@@](C)(O)[C@]([H])5CC2 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/peimine.html |
