Diflunisal
Diflunisal is a difluorophenyl derivate of salicylic acid and a nonsteroidal anti-inflammatory drug (NSAID) with antipyretic, analgesic and anti-inflammatory properties. The mechanism of action of diflunisal is as a cyclooxygenase Inhibitor.
| Trivial name | Fluniget |
| Catalog Number | CSN16177 |
| Alternative Name(s) | Fluniget |
| Research Area | / |
| Molecular Formula | C13H8F2O3 |
| CAS# | 22494-42-4 |
| Purity | ≥99% |
| SMILES | O=C(C1=CC(C2=CC=C(F)C=C2F)=CC=C1O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/diflunisal.html |