Dexmedetomidine HCl
Dexmedetomidine is a selectively activator of presynaptic alpha-2 adrenoceptors located in the brain. This leads to inhibition of postsynaptic activation of adrenoceptors through inhibiting the release of norepinephrine from synaptic vesicles, thereby leading to analgesia, sedation and anxiolysis.
| Trivial name | (+)-Medetomidine HCl |
| Catalog Number | CSN16164 |
| Alternative Name(s) | (+)-Medetomidine HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C13H17ClN2 |
| CAS# | 145108-58-3 |
| Purity | ≥99% |
| SMILES | C[C@H](C1=CN=CN1)C2=CC=CC(C)=C2C.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dexmedetomidine-hcl.html |