Dexmedetomidine HCl
Dexmedetomidine is a selectively activator of presynaptic alpha-2 adrenoceptors located in the brain. This leads to inhibition of postsynaptic activation of adrenoceptors through inhibiting the release of norepinephrine from synaptic vesicles, thereby leading to analgesia, sedation and anxiolysis.

Trivial name | (+)-Medetomidine HCl |
Catalog Number | CSN16164 |
Alternative Name(s) | (+)-Medetomidine HCl |
Research Area | Neurological Disease |
Molecular Formula | C13H17ClN2 |
CAS# | 145108-58-3 |
Purity | ≥99% |
SMILES | C[C@H](C1=CN=CN1)C2=CC=CC(C)=C2C.[H]Cl |
Size | 10mg |
Supplier Page | https://www.csnpharm.com/products/dexmedetomidine-hcl.html |