Picropodophyllin
Picropodophyllotoxin is an orally active insulin-like growth factor-1 receptor (IGF-1R) inhibitor with IC50 of 1 nM, and exhibits little effect towards IR, FGFR, PDGFR and EGFR, and exerts no effects on microtubules and DNA topoisomerase II.
| Trivial name | AXL1717; PPP; Picropodophyllotoxin |
| Catalog Number | CSN16148 |
| Alternative Name(s) | AXL1717; PPP; Picropodophyllotoxin |
| Research Area | Cancer |
| Molecular Formula | C22H22O8 |
| CAS# | 477-47-4 |
| Purity | ≥98% |
| SMILES | O=C1OC[C@]2([H])[C@@H](O)C3=C(C=C4OCOC4=C3)[C@@H](C5=CC(OC)=C(OC)C(OC)=C5)[C@@]21[H] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/picropodophyllin.html |