Cidofovir Dihydrate
Cidofovir is an injectable antiviral medication for the treatment of cytomegalovirus (CMV) retinitis, which suppresses virus replication by selective inhibition of viral DNA synthesis.
| Trivial name | HPMPC Dihydrate |
| Catalog Number | CSN16139 |
| Alternative Name(s) | HPMPC Dihydrate |
| Research Area | Infection |
| Molecular Formula | C8H18N3O8P |
| CAS# | 149394-66-1 |
| Purity | ≥99% |
| SMILES | OC[C@@H](OCP(O)(O)=O)CN1C=CC(N)=NC1=O.[H]O[H].[H]O[H] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cidofovir-dihydrate.html |