Nystose
Nystose is a natural product isolated and purified from the roots of Morinda officinalis How. with anti-hydroxyl radical activity, and can modulate the intestinal Microorganisms flora.
| Trivial name | Nistose |
| Catalog Number | CSN16073 |
| Alternative Name(s) | Nistose |
| Research Area | / |
| Molecular Formula | C24H42O21 |
| CAS# | 13133-07-8 |
| Purity | ≥98% |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@]2([C@H]([C@@H]([C@H](O2)CO)O)O)CO[C@]3([C@H]([C@@H]([C@H](O3)CO)O)O)CO[C@]4([C@H]([C@@H]([C@H](O4)CO)O)O)CO)O)O)O)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/nystose.html |
