Doxycycline HCl
Doxycycline HCl is a broad-spectrum antibiotic used to treat infections caused by bacteria, including pneumonia and other respiratory tract infections, and an MMP inhibitor.
| Trivial name | Vibramycin HCl |
| Catalog Number | CSN15685 |
| Alternative Name(s) | Vibramycin HCl |
| Research Area | Infection |
| Molecular Formula | C22H25ClN2O8 |
| CAS# | 10592-13-9 |
| Purity | ≥98% |
| SMILES | O=C(C1=C(O)[C@@H](N(C)C)[C@@]([C@@H](O)[C@@]2([H])C(C(C3=C(O)C=CC=C3[C@@H]2C)=O)=C4O)([H])[C@@]4(O)C1=O)N.[H]Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/doxycycline-hcl.html |