Brevianamide F
Brevianamide F is an alkaloid metabolite produced by various Streptomyces, Actinomycetes, and Aspergillus strains with antibacterial effect on M. luteus and S. aureus and Bacille Calmette-Guerin M. bovis strain.
| Trivial name | Brevianamide-F |
| Catalog Number | CSN15592 |
| Alternative Name(s) | Brevianamide-F |
| Research Area | / |
| Molecular Formula | C16H17N3O2 |
| CAS# | 38136-70-8 |
| Purity | ≥99% |
| SMILES | O=C(N[C@H]1CC2=CNC3=C2C=CC=C3)[C@@](CCC4)([H])N4C1=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/brevianamide-f.html |
