Rhamnocitrin
Rhamnocitrin can enhance cellular antioxidant defense capacity through regulation of HO-1 expression and MAPK signal transduction. It also exhibits prevention low-density lipoprotein from oxidation and atherogenesis. Rhamnocitrin can be purified from the rhizoma of alpinia officinarum hance,
| Trivial name | / |
| Catalog Number | CSN14291 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H12O6 |
| CAS# | 569-92-6 |
| Purity | ≥98% |
| SMILES | COC1=CC(O)=C(C(C(O)=C2C3=CC=C(O)C=C3)=O)C(O2)=C1 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/rhamnocitrin.html |