Icaritin
Icaritin is a flavonoid that can enhance osteoblastic differentiation of mesenchymal stem cells (MSCs) and display a role of estrogen-like activities. Icaritin could be extracted from the roots of Epimedium brevicornu Maxim with anti-cancer effects.
| Trivial name | Anhydroicaritin |
| Catalog Number | CSN13947 |
| Alternative Name(s) | Anhydroicaritin |
| Research Area | Cancer |
| Molecular Formula | C21H20O6 |
| CAS# | 118525-40-9 |
| Purity | ≥98% |
| SMILES | O=C1C(O)=C(OC2=C(C(O)=CC(O)=C12)C/C=C(C)\C)C3=CC=C(C=C3)OC |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/icaritin.html |
