Rucaparib Phosphate
Rucaparib phosphate is an inhibitor of PARP with Ki of 1.4 nM for PARP1, also showing binding affinity to eight other PARP domains.
| Trivial name | AG014699 Phosphate; PF-01367338 Phosphate |
| Catalog Number | CSN13901 |
| Alternative Name(s) | AG014699 Phosphate; PF-01367338 Phosphate |
| Research Area | Cancer |
| Molecular Formula | C19H21FN3O5P |
| CAS# | 459868-92-9 |
| Purity | ≥99% |
| SMILES | O=C1NCCC2=C(C3=CC=C(CNC)C=C3)NC4=C2C1=CC(F)=C4.O=P(O)(O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/rucaparib-phosphate.html |