Y-27632 2HCl
Y-27632 2HCl is a selective ROCK1 (p160ROCK) inhibitor with Ki of 140 nM, exhibits > 200-fold selectivity over other kinases, including PKC, cAMP-dependent protein kinase, MLCK and PAK.
| Trivial name | / |
| Catalog Number | CSN13895 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C14H23Cl2N3O |
| CAS# | 129830-38-2 |
| Purity | ≥99% |
| SMILES | O=C([C@H]1CC[C@H]([C@H](N)C)CC1)NC2=CC=NC=C2.[H]Cl.[H]Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/y-27632-2hcl.html |
