Omarigliptin
Omarigliptin, also called MA-3102, is an selective inhibitor of DPP-4 with IC50 of 1.6 nM and Ki of 0.8 nM. Its selectivity is higher than other 168 proteasomes.
| Trivial name | MK-3102 |
| Catalog Number | CSN13845 |
| Alternative Name(s) | MK-3102 |
| Research Area | Metabolic Disease |
| Molecular Formula | C17H20F2N4O3S |
| CAS# | 1226781-44-7 |
| Purity | ≥99% |
| SMILES | N[C@@H]1[C@@H](C2=CC(F)=CC=C2F)OC[C@H](N3CC4=NN(S(=O)(C)=O)C=C4C3)C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/omarigliptin.html |