Val-Cit-PAB-OH
Val-Cit-PAB-OH is a linker for ADC through cleaveage by catepsin B only present in lysosome at Val-Cit site, thus making ACD payload be released only in the cell.
| Trivial name | Val-Cit-PAB |
| Catalog Number | CSN13653 |
| Alternative Name(s) | Val-Cit-PAB |
| Research Area | / |
| Molecular Formula | C18H29N5O4 |
| CAS# | 159857-79-1 |
| Purity | ≥99% |
| SMILES | O=C(NC1=CC=C(CO)C=C1)[C@@H](NC([C@@H](N)C(C)C)=O)CCCNC(N)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/val-cit-pab-oh.html |
