Dihydroartemisinin
Dihydroartemisinin is a semi-synthetic derivative of artemisinin and isolated from the traditional Chinese herb Artemisia annua with anti-cancer and antimalarial activities.
| Trivial name | DHQHS 2; Dihydroqinghaosu |
| Catalog Number | CSN13612 |
| Alternative Name(s) | DHQHS 2; Dihydroqinghaosu |
| Research Area | Cancer|Infection |
| Molecular Formula | C15H24O5 |
| CAS# | 71939-50-9 |
| Purity | ≥98% |
| SMILES | O[C@H]1O[C@@]2([H])[C@@]3(OO[C@](O2)(C)CC4)[C@]4([H])[C@H](C)CC[C@@]3([H])[C@H]1C |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/dihydroartemisinin.html |
