SKF-38393 HCl
SKF-38393 HCl is an agonist of dopamine D1 receptor (the IC50 value is 110 nM). It has anorectic and stimulant effects.
| Trivial name | (±)-SKF-38393 HCl; SKF 38393A |
| Catalog Number | CSN13576 |
| Alternative Name(s) | (±)-SKF-38393 HCl; SKF 38393A |
| Research Area | Neurological Disease |
| Molecular Formula | C16H18ClNO2 |
| CAS# | 62717-42-4 |
| Purity | ≥99% |
| SMILES | OC1=C(O)C=C2C(C3=CC=CC=C3)CNCCC2=C1.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/skf-38393-hcl.html |