Pectolinarigenin
Pectolinarigenin is a dimethoxyflavone extracted from the leaves of Linaria vulgaris Mill and it has been found to specifically bind to the nuclear receptor RARγ (IC50 = 3.42 μM) to activate the JNK signaling pathway and induce apoptosis.
| Trivial name | / |
| Catalog Number | CSN13500 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C17H14O6 |
| CAS# | 520-12-7 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=C(OC)C=C2)OC3=CC(O)=C(OC)C(O)=C13 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/pectolinarigenin.html |