Conivaptan HCl
Conivaptan HCl is an inhibitor of antidiuretic hormone or antagonist of vasopressin receptor. It can inhibit rat liver V1A receptor and kidney V2 receptor with Ki of 0.48 nM and 3.04 nM, respectively.
| Trivial name | YM 087 |
| Catalog Number | CSN13437 |
| Alternative Name(s) | YM 087 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C32H27ClN4O2 |
| CAS# | 168626-94-6 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC=CC=C1C2=CC=CC=C2)NC3=CC=C(C(N4C5=CC=CC=C5C(NC(C)=N6)=C6CC4)=O)C=C3.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/conivaptan-hcl.html |