Fluconazole
Fluconazole, an inhibitor of CYP2C19, CYP2C9 and CYP3A4, is a triazole antifungal drug used in the treatment and prevention of superficial and systemic fungal infections.
| Trivial name | UK-49858 |
| Catalog Number | CSN13053 |
| Alternative Name(s) | UK-49858 |
| Research Area | Infection |
| Molecular Formula | C13H12F2N6O |
| CAS# | 86386-73-4 |
| Purity | ≥99% |
| SMILES | FC1=CC(F)=C(C(O)(CN2N=CN=C2)CN3N=CN=C3)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/fluconazole.html |
